C19H18FNO4 — CID 102132663
methyl 3-(3-fluorophenyl)-2-[[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 102132663) has the molecular formula C19H18FNO4 and a molecular weight of 343.35 g/mol. Its IUPAC name is methyl 3-(3-fluorophenyl)-2-[[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-(3-fluorophenyl)-2-[[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 102132663 |
| Molecular Formula | C19H18FNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | methyl 3-(3-fluorophenyl)-2-[[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1cccc(F)c1)NC(=O)/C=C/c1ccccc1O |
| InChI | InChI=1S/C19H18FNO4/c1-25-19(24)16(12-13-5-4-7-15(20)11-13)21-18(23)10-9-14-6-2-3-8-17(14)22/h2-11,16,22H,12H2,1H3,(H,21,23)/b10-9+ |
| InChIKey | CTQLGJPXGPBYQJ-MDZDMXLPSA-N |
| XLogP | 2.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|