C21H20FNO5 — CID 46607823
methyl 2-[[2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-3-phenylpropanoate (PubChem CID 46607823) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is methyl 2-[[2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46607823 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 2-[[2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)COC(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C21H20FNO5/c1-27-21(26)18(13-15-7-3-2-4-8-15)23-19(24)14-28-20(25)12-11-16-9-5-6-10-17(16)22/h2-12,18H,13-14H2,1H3,(H,23,24)/b12-11+ |
| InChIKey | PELMCGAGTGHBNU-VAWYXSNFSA-N |
| XLogP | 2.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|