C16H19NO4 — CID 7981212
[2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] (E)-but-2-enoate (PubChem CID 7981212) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] (E)-but-2-enoate.
| Compound Name | [2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7981212 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)N[C@H](Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C16H19NO4/c1-3-7-16(20)21-11-15(19)17-14(12(2)18)10-13-8-5-4-6-9-13/h3-9,14H,10-11H2,1-2H3,(H,17,19)/b7-3+/t14-/m1/s1 |
| InChIKey | YRMXMBYHHMJCEU-UFZAZABTSA-N |
| XLogP | 1.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|