C18H21NO7 — CID 9015550
1-O-ethyl 4-O-[2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate (PubChem CID 9015550) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 9015550 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-O-ethyl 4-O-[2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)N[C@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H21NO7/c1-3-25-16(21)9-10-17(22)26-12-15(20)19-14(18(23)24-2)11-13-7-5-4-6-8-13/h4-10,14H,3,11-12H2,1-2H3,(H,19,20)/b10-9+/t14-/m1/s1 |
| InChIKey | XURIQTXPEOWMOZ-ATWMFIQVSA-N |
| XLogP | 0.55 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|