C20H21NO5 — CID 55397418
[2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 4-methylbenzoate (PubChem CID 55397418) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is [2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 4-methylbenzoate.
| Compound Name | [2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 55397418 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 4-methylbenzoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO5/c1-14-8-10-16(11-9-14)19(23)26-13-18(22)21-17(20(24)25-2)12-15-6-4-3-5-7-15/h3-11,17H,12-13H2,1-2H3,(H,21,22) |
| InChIKey | NBAHAZVRHFPTPV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |