C19H16Cl3NO5 — CID 55398580
[2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 55398580) has the molecular formula C19H16Cl3NO5 and a molecular weight of 444.70 g/mol. Its IUPAC name is [2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 55398580 |
| Molecular Formula | C19H16Cl3NO5 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | [2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)COC(=O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C19H16Cl3NO5/c1-27-18(25)14(9-11-5-3-2-4-6-11)23-15(24)10-28-19(26)16-12(20)7-8-13(21)17(16)22/h2-8,14H,9-10H2,1H3,(H,23,24) |
| InChIKey | NSAKXPSVRUEKPS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|