C21H23NO6 — CID 9197641
[2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 9197641) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is [2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 9197641 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)N[C@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C21H23NO6/c1-3-27-18-12-8-7-11-16(18)20(24)28-14-19(23)22-17(21(25)26-2)13-15-9-5-4-6-10-15/h4-12,17H,3,13-14H2,1-2H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | WPVQMBRFUBUZDX-QGZVFWFLSA-N |
| XLogP | 2.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |