C20H17NO7 — CID 137462354
2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoic acid (PubChem CID 137462354) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is 2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 137462354 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)/C=C/c1ccc(O)c2oc(-c3ccc(O)c(O)c3)cc12)C(=O)O |
| InChI | InChI=1S/C20H17NO7/c1-10(20(26)27)21-18(25)7-4-11-2-6-15(23)19-13(11)9-17(28-19)12-3-5-14(22)16(24)8-12/h2-10,22-24H,1H3,(H,21,25)(H,26,27)/b7-4+ |
| InChIKey | PLOXCJNRUKJVPD-QPJJXVBHSA-N |
| XLogP | 2.82 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|