C27H22O9 — CID 160958952
(E,2S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]-2-[(3,4-dihydroxyphenyl)methyl]-4-oxohex-5-enoic acid (PubChem CID 160958952) has the molecular formula C27H22O9 and a molecular weight of 490.46 g/mol. Its IUPAC name is (E,2S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]-2-[(3,4-dihydroxyphenyl)methyl]-4-oxohex-5-enoic acid.
| Compound Name | (E,2S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]-2-[(3,4-dihydroxyphenyl)methyl]-4-oxohex-5-enoic acid |
|---|---|
| PubChem CID | 160958952 |
| Molecular Formula | C27H22O9 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (E,2S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]-2-[(3,4-dihydroxyphenyl)methyl]-4-oxohex-5-enoic acid |
| SMILES | O=C(/C=C/c1ccc(O)c2oc(-c3ccc(O)c(O)c3)cc12)C[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C27H22O9/c28-18(11-17(27(34)35)9-14-1-6-20(29)23(32)10-14)5-2-15-3-8-22(31)26-19(15)13-25(36-26)16-4-7-21(30)24(33)12-16/h1-8,10,12-13,17,29-33H,9,11H2,(H,34,35)/b5-2+/t17-/m0/s1 |
| InChIKey | SWTMJQJFUNTQKY-RTZWDOBSSA-N |
| XLogP | 4.54 |
| TPSA | 168.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|