C28H22O10 — CID 163071923
(2R)-3-(3,4-dihydroxyphenyl)-2-[3-[7-(3,4-dihydroxyphenyl)-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]propanoic acid (PubChem CID 163071923) has the molecular formula C28H22O10 and a molecular weight of 518.47 g/mol. Its IUPAC name is (2R)-3-(3,4-dihydroxyphenyl)-2-[3-[7-(3,4-dihydroxyphenyl)-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]propanoic acid.
| Compound Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[3-[7-(3,4-dihydroxyphenyl)-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]propanoic acid |
|---|---|
| PubChem CID | 163071923 |
| Molecular Formula | C28H22O10 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[3-[7-(3,4-dihydroxyphenyl)-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]propanoic acid |
| SMILES | O=C(C=Cc1cc(O)c(O)c2ccc(-c3ccc(O)c(O)c3)cc12)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C28H22O10/c29-20-6-1-14(9-22(20)31)10-25(28(36)37)38-26(34)8-4-17-13-24(33)27(35)18-5-2-15(11-19(17)18)16-3-7-21(30)23(32)12-16/h1-9,11-13,25,29-33,35H,10H2,(H,36,37)/t25-/m1/s1 |
| InChIKey | KJQSLBDGFDGSOC-RUZDIDTESA-N |
| XLogP | 3.99 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|