C34H26O11 — CID 163063052
2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 163063052) has the molecular formula C34H26O11 and a molecular weight of 610.57 g/mol. Its IUPAC name is 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 163063052 |
| Molecular Formula | C34H26O11 |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | O=C(C=Cc1cc(O)c(O)c2ccc(-c3cc(O)c(O)cc3-c3cccc(O)c3)cc12)OC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C34H26O11/c35-21-3-1-2-18(12-21)24-15-28(38)29(39)16-25(24)19-5-7-22-23(13-19)20(14-30(40)33(22)42)6-9-32(41)45-31(34(43)44)11-17-4-8-26(36)27(37)10-17/h1-10,12-16,31,35-40,42H,11H2,(H,43,44) |
| InChIKey | KMIYIWALBYNJMM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|