C39H36O11 — CID 162832899
(2R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]oct-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 162832899) has the molecular formula C39H36O11 and a molecular weight of 680.71 g/mol. Its IUPAC name is (2R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]oct-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]oct-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 162832899 |
| Molecular Formula | C39H36O11 |
| Molecular Weight | 680.71 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | (2R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]oct-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | CCCCC/C(=C\C(=O)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O)c1cc(O)c(O)c2ccc(-c3cc(O)c(O)cc3-c3cccc(O)c3)cc12 |
| InChI | InChI=1S/C39H36O11/c1-2-3-4-6-23(17-37(46)50-36(39(48)49)14-21-9-12-31(41)32(42)13-21)29-20-35(45)38(47)26-11-10-24(16-30(26)29)28-19-34(44)33(43)18-27(28)22-7-5-8-25(40)15-22/h5,7-13,15-20,36,40-45,47H,2-4,6,14H2,1H3,(H,48,49)/b23-17+/t36-/m1/s1 |
| InChIKey | DYMNWWQSNDROAV-WAVMPYPISA-N |
| XLogP | 7.32 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.71 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|