C12H14O6 — CID 123213816
3-(3,4-dihydroxyphenyl)-2-propanoyloxypropanoic acid (PubChem CID 123213816) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-propanoyloxypropanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-propanoyloxypropanoic acid |
|---|---|
| PubChem CID | 123213816 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-propanoyloxypropanoic acid |
| SMILES | CCC(=O)OC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C12H14O6/c1-2-11(15)18-10(12(16)17)6-7-3-4-8(13)9(14)5-7/h3-5,10,13-14H,2,6H2,1H3,(H,16,17) |
| InChIKey | SOOJYFXBDVOZCE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|