C27H22O10 — CID 54147492
3-(3,4-dihydroxyphenyl)-2-[(1E)-1-[1-(3,4-dihydroxyphenyl)ethylidene]-6,7-dihydroxyindene-2-carbonyl]oxypropanoic acid (PubChem CID 54147492) has the molecular formula C27H22O10 and a molecular weight of 506.46 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-[(1E)-1-[1-(3,4-dihydroxyphenyl)ethylidene]-6,7-dihydroxyindene-2-carbonyl]oxypropanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-[(1E)-1-[1-(3,4-dihydroxyphenyl)ethylidene]-6,7-dihydroxyindene-2-carbonyl]oxypropanoic acid |
|---|---|
| PubChem CID | 54147492 |
| Molecular Formula | C27H22O10 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-[(1E)-1-[1-(3,4-dihydroxyphenyl)ethylidene]-6,7-dihydroxyindene-2-carbonyl]oxypropanoic acid |
| SMILES | C/C(=C1\C(C(=O)OC(Cc2ccc(O)c(O)c2)C(=O)O)=Cc2ccc(O)c(O)c21)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H22O10/c1-12(14-3-6-18(29)21(32)11-14)23-16(10-15-4-7-19(30)25(33)24(15)23)27(36)37-22(26(34)35)9-13-2-5-17(28)20(31)8-13/h2-8,10-11,22,28-33H,9H2,1H3,(H,34,35)/b23-12- |
| InChIKey | OFKPIJUCTKNYPO-FMCGGJTJSA-N |
| XLogP | 3.49 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|