C26H22O10 — CID 102232478
(2S)-3-(3,4-dihydroxyphenyl)-2-[(3S)-3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carbonyl]oxypropanoic acid (PubChem CID 102232478) has the molecular formula C26H22O10 and a molecular weight of 494.45 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-[(3S)-3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carbonyl]oxypropanoic acid.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[(3S)-3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carbonyl]oxypropanoic acid |
|---|---|
| PubChem CID | 102232478 |
| Molecular Formula | C26H22O10 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[(3S)-3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carbonyl]oxypropanoic acid |
| SMILES | O=C(O[C@@H](Cc1ccc(O)c(O)c1)C(=O)O)C1=Cc2ccc(O)c(O)c2C[C@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H22O10/c27-18-4-1-12(7-21(18)30)8-23(25(33)34)36-26(35)17-9-13-3-6-20(29)24(32)16(13)11-15(17)14-2-5-19(28)22(31)10-14/h1-7,9-10,15,23,27-32H,8,11H2,(H,33,34)/t15-,23-/m0/s1 |
| InChIKey | LVMDOOASNBVTDK-WNSKOXEYSA-N |
| XLogP | 2.88 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|