C38H34O16 — CID 139602075
3-[3-[1-carboxy-3-(3,4-dihydroxyphenyl)propan-2-yl]oxycarbonyl-2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-1,2-dihydronaphthalene-1-carbonyl]oxy-4-(3,4-dihydroxyphenyl)butanoic acid (PubChem CID 139602075) has the molecular formula C38H34O16 and a molecular weight of 746.67 g/mol. Its IUPAC name is 3-[3-[1-carboxy-3-(3,4-dihydroxyphenyl)propan-2-yl]oxycarbonyl-2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-1,2-dihydronaphthalene-1-carbonyl]oxy-4-(3,4-dihydroxyphenyl)butanoic acid.
| Compound Name | 3-[3-[1-carboxy-3-(3,4-dihydroxyphenyl)propan-2-yl]oxycarbonyl-2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-1,2-dihydronaphthalene-1-carbonyl]oxy-4-(3,4-dihydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 139602075 |
| Molecular Formula | C38H34O16 |
| Molecular Weight | 746.67 g/mol |
| Exact Mass | 746.18 |
| IUPAC Name | 3-[3-[1-carboxy-3-(3,4-dihydroxyphenyl)propan-2-yl]oxycarbonyl-2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-1,2-dihydronaphthalene-1-carbonyl]oxy-4-(3,4-dihydroxyphenyl)butanoic acid |
| SMILES | O=C(O)CC(Cc1ccc(O)c(O)c1)OC(=O)C1=Cc2ccc(O)c(O)c2C(C(=O)OC(CC(=O)O)Cc2ccc(O)c(O)c2)C1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C38H34O16/c39-24-5-1-17(11-28(24)43)9-21(15-31(46)47)53-37(51)23-13-19-4-8-27(42)36(50)34(19)35(33(23)20-3-7-26(41)30(45)14-20)38(52)54-22(16-32(48)49)10-18-2-6-25(40)29(44)12-18/h1-8,11-14,21-22,33,35,39-45,50H,9-10,15-16H2,(H,46,47)(H,48,49) |
| InChIKey | NOKBWSBPUIOVFB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 289.04 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|