C12H17NO4 — CID 162806885
3-(3,4-dihydroxyphenyl)-2-(trimethylazaniumyl)propanoate (PubChem CID 162806885) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-(trimethylazaniumyl)propanoate.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-(trimethylazaniumyl)propanoate |
|---|---|
| PubChem CID | 162806885 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-(trimethylazaniumyl)propanoate |
| SMILES | C[N+](C)(C)C(Cc1ccc(O)c(O)c1)C(=O)[O-] |
| InChI | InChI=1S/C12H17NO4/c1-13(2,3)9(12(16)17)6-8-4-5-10(14)11(15)7-8/h4-5,7,9H,6H2,1-3H3,(H2-,14,15,16,17) |
| InChIKey | QTDANWSNWNJHDD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|