C10H13NO3S — CID 123598248
S-methyl 2-amino-3-(3,4-dihydroxyphenyl)propanethioate (PubChem CID 123598248) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is S-methyl 2-amino-3-(3,4-dihydroxyphenyl)propanethioate.
| Compound Name | S-methyl 2-amino-3-(3,4-dihydroxyphenyl)propanethioate |
|---|---|
| PubChem CID | 123598248 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | S-methyl 2-amino-3-(3,4-dihydroxyphenyl)propanethioate |
| SMILES | CSC(=O)C(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H13NO3S/c1-15-10(14)7(11)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,12-13H,4,11H2,1H3 |
| InChIKey | TVGIONIFVSTJFT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|