C22H25N3O5S2 — CID 123898372
S-[[3-(2-amino-3-methylsulfanyl-3-oxopropyl)-5-hydroxy-1H-indol-7-yl]methyl] 2-amino-3-(3,4-dihydroxyphenyl)propanethioate (PubChem CID 123898372) has the molecular formula C22H25N3O5S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is S-[[3-(2-amino-3-methylsulfanyl-3-oxopropyl)-5-hydroxy-1H-indol-7-yl]methyl] 2-amino-3-(3,4-dihydroxyphenyl)propanethioate.
| Compound Name | S-[[3-(2-amino-3-methylsulfanyl-3-oxopropyl)-5-hydroxy-1H-indol-7-yl]methyl] 2-amino-3-(3,4-dihydroxyphenyl)propanethioate |
|---|---|
| PubChem CID | 123898372 |
| Molecular Formula | C22H25N3O5S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | S-[[3-(2-amino-3-methylsulfanyl-3-oxopropyl)-5-hydroxy-1H-indol-7-yl]methyl] 2-amino-3-(3,4-dihydroxyphenyl)propanethioate |
| SMILES | CSC(=O)C(N)Cc1c[nH]c2c(CSC(=O)C(N)Cc3ccc(O)c(O)c3)cc(O)cc12 |
| InChI | InChI=1S/C22H25N3O5S2/c1-31-21(29)17(24)7-12-9-25-20-13(6-14(26)8-15(12)20)10-32-22(30)16(23)4-11-2-3-18(27)19(28)5-11/h2-3,5-6,8-9,16-17,25-28H,4,7,10,23-24H2,1H3 |
| InChIKey | IEKSPQFIKQQVGJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 162.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|