C22H27N3O4S — CID 123872019
3-amino-4-[7-[[2-(3,4-dihydroxyphenyl)ethylamino]sulfanylmethyl]-5-methoxy-1H-indol-3-yl]butan-2-one (PubChem CID 123872019) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is 3-amino-4-[7-[[2-(3,4-dihydroxyphenyl)ethylamino]sulfanylmethyl]-5-methoxy-1H-indol-3-yl]butan-2-one.
| Compound Name | 3-amino-4-[7-[[2-(3,4-dihydroxyphenyl)ethylamino]sulfanylmethyl]-5-methoxy-1H-indol-3-yl]butan-2-one |
|---|---|
| PubChem CID | 123872019 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-amino-4-[7-[[2-(3,4-dihydroxyphenyl)ethylamino]sulfanylmethyl]-5-methoxy-1H-indol-3-yl]butan-2-one |
| SMILES | COc1cc(CSNCCc2ccc(O)c(O)c2)c2[nH]cc(CC(N)C(C)=O)c2c1 |
| InChI | InChI=1S/C22H27N3O4S/c1-13(26)19(23)9-15-11-24-22-16(8-17(29-2)10-18(15)22)12-30-25-6-5-14-3-4-20(27)21(28)7-14/h3-4,7-8,10-11,19,24-25,27-28H,5-6,9,12,23H2,1-2H3 |
| InChIKey | HRNRNXASYGFJGV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|