C11H15NO4 — CID 70879837
methyl 3-amino-4-(3,4-dihydroxyphenyl)butanoate (PubChem CID 70879837) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl 3-amino-4-(3,4-dihydroxyphenyl)butanoate.
| Compound Name | methyl 3-amino-4-(3,4-dihydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 70879837 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl 3-amino-4-(3,4-dihydroxyphenyl)butanoate |
| SMILES | COC(=O)CC(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H15NO4/c1-16-11(15)6-8(12)4-7-2-3-9(13)10(14)5-7/h2-3,5,8,13-14H,4,6,12H2,1H3 |
| InChIKey | BCUGXPGGRJAQTN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|