C14H19NO2 — CID 82351473
methyl 3-amino-4-(2,3-dihydro-1H-inden-5-yl)butanoate (PubChem CID 82351473) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl 3-amino-4-(2,3-dihydro-1H-inden-5-yl)butanoate.
| Compound Name | methyl 3-amino-4-(2,3-dihydro-1H-inden-5-yl)butanoate |
|---|---|
| PubChem CID | 82351473 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | methyl 3-amino-4-(2,3-dihydro-1H-inden-5-yl)butanoate |
| SMILES | COC(=O)CC(N)Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H19NO2/c1-17-14(16)9-13(15)8-10-5-6-11-3-2-4-12(11)7-10/h5-7,13H,2-4,8-9,15H2,1H3 |
| InChIKey | GBCKLEHVBGPLCI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |