C15H21NO2 — CID 115232486
methyl 3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoate (PubChem CID 115232486) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl 3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoate.
| Compound Name | methyl 3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoate |
|---|---|
| PubChem CID | 115232486 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | methyl 3-[2-(2,3-dihydro-1H-inden-5-yl)ethylamino]propanoate |
| SMILES | COC(=O)CCNCCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21NO2/c1-18-15(17)8-10-16-9-7-12-5-6-13-3-2-4-14(13)11-12/h5-6,11,16H,2-4,7-10H2,1H3 |
| InChIKey | YLRYSLPTNNUXOH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|