3-(2,3-dihydro-1H-inden-5-yl)propanoic acid

C12H14O2 — CID 12646159

IUPAC3-(2,3-dihydro-1H-inden-5-yl)propanoic acid
SMILESO=C(O)CCc1ccc2c(c1)CCC2
InChIInChI=1S/C12H14O2/c13-12(14)7-5-9-4-6-10-2-1-3-11(10)8-9/h4,6,8H,1-3,5,7H2,(H,13,14)
InChIKeyRYDLHBJFDFGPNP-UHFFFAOYSA-N
MW190.24 g/mol
LogP2.19
Rot. Bonds3

About 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid

3-(2,3-dihydro-1H-inden-5-yl)propanoic acid (PubChem CID 12646159) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(2,3-dihydro-1H-inden-5-yl)propanoic acid
PubChem CID12646159
Molecular FormulaC12H14O2
Molecular Weight190.24 g/mol
Exact Mass190.10
IUPAC Name3-(2,3-dihydro-1H-inden-5-yl)propanoic acid
SMILESO=C(O)CCc1ccc2c(c1)CCC2
InChIInChI=1S/C12H14O2/c13-12(14)7-5-9-4-6-10-2-1-3-11(10)8-9/h4,6,8H,1-3,5,7H2,(H,13,14)
InChIKeyRYDLHBJFDFGPNP-UHFFFAOYSA-N
XLogP2.19
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.24
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid?
The IUPAC name of 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid (CID 12646159) is 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid.
What is the SMILES notation for 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid?
The canonical SMILES for 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid is O=C(O)CCc1ccc2c(c1)CCC2.
What is the InChIKey of 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid?
The InChIKey is RYDLHBJFDFGPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c13-12(14)7-5-9-4-6-10-2-1-3-11(10)8-9/h4,6,8H,1-3,5,7H2,(H,13,14).
What are the key properties of 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid?
3-(2,3-dihydro-1H-inden-5-yl)propanoic acid has a molecular weight of 190.24 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid is sourced from PubChem (CID 12646159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).