C12H15NO2 — CID 174986935
2-(2,3-dihydro-1H-inden-5-yl)ethyl carbamate (PubChem CID 174986935) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)ethyl carbamate.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)ethyl carbamate |
|---|---|
| PubChem CID | 174986935 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)ethyl carbamate |
| SMILES | NC(=O)OCCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H15NO2/c13-12(14)15-7-6-9-4-5-10-2-1-3-11(10)8-9/h4-5,8H,1-3,6-7H2,(H2,13,14) |
| InChIKey | FFWMSTRDEJXZAB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |