C11H16ClN — CID 135381745
2-(2,3-dihydro-1H-inden-5-yl)ethanamine;hydrochloride (PubChem CID 135381745) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)ethanamine;hydrochloride.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 135381745 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H15N.ClH/c12-7-6-9-4-5-10-2-1-3-11(10)8-9;/h4-5,8H,1-3,6-7,12H2;1H |
| InChIKey | CPUJZKKNENAFQW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |