C13H17Cl — CID 64514679
5-(4-chlorobutyl)-2,3-dihydro-1H-indene (PubChem CID 64514679) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 5-(4-chlorobutyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(4-chlorobutyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 64514679 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 5-(4-chlorobutyl)-2,3-dihydro-1H-indene |
| SMILES | ClCCCCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H17Cl/c14-9-2-1-4-11-7-8-12-5-3-6-13(12)10-11/h7-8,10H,1-6,9H2 |
| InChIKey | ANOUHTMXXLGAJH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|