C15H21ClO2S — CID 62229484
5-(6-chlorohexylsulfonyl)-2,3-dihydro-1H-indene (PubChem CID 62229484) has the molecular formula C15H21ClO2S and a molecular weight of 300.85 g/mol. Its IUPAC name is 5-(6-chlorohexylsulfonyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(6-chlorohexylsulfonyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 62229484 |
| Molecular Formula | C15H21ClO2S |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-(6-chlorohexylsulfonyl)-2,3-dihydro-1H-indene |
| SMILES | O=S(=O)(CCCCCCCl)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21ClO2S/c16-10-3-1-2-4-11-19(17,18)15-9-8-13-6-5-7-14(13)12-15/h8-9,12H,1-7,10-11H2 |
| InChIKey | BQZGIQXWTQECAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|