C14H20O2S — CID 158665045
6-butylsulfonyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 158665045) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 6-butylsulfonyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-butylsulfonyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 158665045 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 6-butylsulfonyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCS(=O)(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H20O2S/c1-2-3-10-17(15,16)14-9-8-12-6-4-5-7-13(12)11-14/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | ALEYMMUNDQZYPB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |