C15H23NO2S — CID 64647431
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-propylpropan-2-amine (PubChem CID 64647431) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-propylpropan-2-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 64647431 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-propylpropan-2-amine |
| SMILES | CCCNC(C)CS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H23NO2S/c1-3-9-16-12(2)11-19(17,18)15-8-7-13-5-4-6-14(13)10-15/h7-8,10,12,16H,3-6,9,11H2,1-2H3 |
| InChIKey | CHPVTRCSWYGWGH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |