C14H19BrO2S — CID 65000038
5-(3-bromo-2,2-dimethylpropyl)sulfonyl-2,3-dihydro-1H-indene (PubChem CID 65000038) has the molecular formula C14H19BrO2S and a molecular weight of 331.28 g/mol. Its IUPAC name is 5-(3-bromo-2,2-dimethylpropyl)sulfonyl-2,3-dihydro-1H-indene.
| Compound Name | 5-(3-bromo-2,2-dimethylpropyl)sulfonyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 65000038 |
| Molecular Formula | C14H19BrO2S |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 5-(3-bromo-2,2-dimethylpropyl)sulfonyl-2,3-dihydro-1H-indene |
| SMILES | CC(C)(CBr)CS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H19BrO2S/c1-14(2,9-15)10-18(16,17)13-7-6-11-4-3-5-12(11)8-13/h6-8H,3-5,9-10H2,1-2H3 |
| InChIKey | UEWJUBGWVPACBU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|