C15H20O3S — CID 64641999
6-(2,3-dihydro-1H-inden-5-ylsulfonyl)hexan-2-one (PubChem CID 64641999) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-5-ylsulfonyl)hexan-2-one.
| Compound Name | 6-(2,3-dihydro-1H-inden-5-ylsulfonyl)hexan-2-one |
|---|---|
| PubChem CID | 64641999 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-5-ylsulfonyl)hexan-2-one |
| SMILES | CC(=O)CCCCS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H20O3S/c1-12(16)5-2-3-10-19(17,18)15-9-8-13-6-4-7-14(13)11-15/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | GVLUHLPIARIWQC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|