C12H15N3O2S — CID 61397011
5-(3-azidopropylsulfonyl)-2,3-dihydro-1H-indene (PubChem CID 61397011) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 5-(3-azidopropylsulfonyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(3-azidopropylsulfonyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 61397011 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-(3-azidopropylsulfonyl)-2,3-dihydro-1H-indene |
| SMILES | [N-]=[N+]=NCCCS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H15N3O2S/c13-15-14-7-2-8-18(16,17)12-6-5-10-3-1-4-11(10)9-12/h5-6,9H,1-4,7-8H2 |
| InChIKey | XPMRAXZJBDANAD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|