C13H17N3O — CID 61398910
6-(3-azidopropoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 61398910) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 6-(3-azidopropoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(3-azidopropoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 61398910 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 6-(3-azidopropoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | [N-]=[N+]=NCCCOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H17N3O/c14-16-15-8-3-9-17-13-7-6-11-4-1-2-5-12(11)10-13/h6-7,10H,1-5,8-9H2 |
| InChIKey | KZQDMDASJIFMRB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|