C15H19NO — CID 54965695
5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanenitrile (PubChem CID 54965695) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanenitrile.
| Compound Name | 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanenitrile |
|---|---|
| PubChem CID | 54965695 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanenitrile |
| SMILES | N#CCCCCOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H19NO/c16-10-4-1-5-11-17-15-9-8-13-6-2-3-7-14(13)12-15/h8-9,12H,1-7,11H2 |
| InChIKey | UPZVTSGNGRJNGY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|