C18H19BrO2 — CID 63457392
6-[2-(3-bromophenoxy)ethoxy]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63457392) has the molecular formula C18H19BrO2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 6-[2-(3-bromophenoxy)ethoxy]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[2-(3-bromophenoxy)ethoxy]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63457392 |
| Molecular Formula | C18H19BrO2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 6-[2-(3-bromophenoxy)ethoxy]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Brc1cccc(OCCOc2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C18H19BrO2/c19-16-6-3-7-17(13-16)20-10-11-21-18-9-8-14-4-1-2-5-15(14)12-18/h3,6-9,12-13H,1-2,4-5,10-11H2 |
| InChIKey | XGDKUJVONWGZCN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|