C14H11BrCl2O2 — CID 60626996
4-[2-(3-bromophenoxy)ethoxy]-1,2-dichlorobenzene (PubChem CID 60626996) has the molecular formula C14H11BrCl2O2 and a molecular weight of 362.05 g/mol. Its IUPAC name is 4-[2-(3-bromophenoxy)ethoxy]-1,2-dichlorobenzene.
| Compound Name | 4-[2-(3-bromophenoxy)ethoxy]-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 60626996 |
| Molecular Formula | C14H11BrCl2O2 |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 4-[2-(3-bromophenoxy)ethoxy]-1,2-dichlorobenzene |
| SMILES | Clc1ccc(OCCOc2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C14H11BrCl2O2/c15-10-2-1-3-11(8-10)18-6-7-19-12-4-5-13(16)14(17)9-12/h1-5,8-9H,6-7H2 |
| InChIKey | PWUAEKBFNSIYKN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|