C14H12BrCl2NO2 — CID 107498125
2-[2-(3-bromophenoxy)ethoxy]-4,5-dichloroaniline (PubChem CID 107498125) has the molecular formula C14H12BrCl2NO2 and a molecular weight of 377.07 g/mol. Its IUPAC name is 2-[2-(3-bromophenoxy)ethoxy]-4,5-dichloroaniline.
| Compound Name | 2-[2-(3-bromophenoxy)ethoxy]-4,5-dichloroaniline |
|---|---|
| PubChem CID | 107498125 |
| Molecular Formula | C14H12BrCl2NO2 |
| Molecular Weight | 377.07 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 2-[2-(3-bromophenoxy)ethoxy]-4,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(Cl)cc1OCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C14H12BrCl2NO2/c15-9-2-1-3-10(6-9)19-4-5-20-14-8-12(17)11(16)7-13(14)18/h1-3,6-8H,4-5,18H2 |
| InChIKey | RSXGHMMIGXDFQC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.07 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|