C15H14BrCl2NO2 — CID 63499735
[2-[2-(3-bromophenoxy)ethoxy]-3,5-dichlorophenyl]methanamine (PubChem CID 63499735) has the molecular formula C15H14BrCl2NO2 and a molecular weight of 391.09 g/mol. Its IUPAC name is [2-[2-(3-bromophenoxy)ethoxy]-3,5-dichlorophenyl]methanamine.
| Compound Name | [2-[2-(3-bromophenoxy)ethoxy]-3,5-dichlorophenyl]methanamine |
|---|---|
| PubChem CID | 63499735 |
| Molecular Formula | C15H14BrCl2NO2 |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | [2-[2-(3-bromophenoxy)ethoxy]-3,5-dichlorophenyl]methanamine |
| SMILES | NCc1cc(Cl)cc(Cl)c1OCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C15H14BrCl2NO2/c16-11-2-1-3-13(7-11)20-4-5-21-15-10(9-19)6-12(17)8-14(15)18/h1-3,6-8H,4-5,9,19H2 |
| InChIKey | XFXRDOOEYISXLI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|