C15H13Cl4NO2 — CID 22684932
[5-chloro-2-[2-(2,4,6-trichlorophenoxy)ethoxy]phenyl]methanamine (PubChem CID 22684932) has the molecular formula C15H13Cl4NO2 and a molecular weight of 381.09 g/mol. Its IUPAC name is [5-chloro-2-[2-(2,4,6-trichlorophenoxy)ethoxy]phenyl]methanamine.
| Compound Name | [5-chloro-2-[2-(2,4,6-trichlorophenoxy)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 22684932 |
| Molecular Formula | C15H13Cl4NO2 |
| Molecular Weight | 381.09 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | [5-chloro-2-[2-(2,4,6-trichlorophenoxy)ethoxy]phenyl]methanamine |
| SMILES | NCc1cc(Cl)ccc1OCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl4NO2/c16-10-1-2-14(9(5-10)8-20)21-3-4-22-15-12(18)6-11(17)7-13(15)19/h1-2,5-7H,3-4,8,20H2 |
| InChIKey | AGERFWBEZFTYJZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.09 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|