C9H10Cl3NO — CID 10060902
3-(2,4,6-trichlorophenoxy)propan-1-amine (PubChem CID 10060902) has the molecular formula C9H10Cl3NO and a molecular weight of 254.54 g/mol. Its IUPAC name is 3-(2,4,6-trichlorophenoxy)propan-1-amine.
| Compound Name | 3-(2,4,6-trichlorophenoxy)propan-1-amine |
|---|---|
| PubChem CID | 10060902 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 3-(2,4,6-trichlorophenoxy)propan-1-amine |
| SMILES | NCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl3NO/c10-6-4-7(11)9(8(12)5-6)14-3-1-2-13/h4-5H,1-3,13H2 |
| InChIKey | QWMQUUNOHDPHHI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|