C11H13Cl3O2 — CID 62229545
5-(2,4,6-trichlorophenoxy)pentan-1-ol (PubChem CID 62229545) has the molecular formula C11H13Cl3O2 and a molecular weight of 283.58 g/mol. Its IUPAC name is 5-(2,4,6-trichlorophenoxy)pentan-1-ol.
| Compound Name | 5-(2,4,6-trichlorophenoxy)pentan-1-ol |
|---|---|
| PubChem CID | 62229545 |
| Molecular Formula | C11H13Cl3O2 |
| Molecular Weight | 283.58 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 5-(2,4,6-trichlorophenoxy)pentan-1-ol |
| SMILES | OCCCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl3O2/c12-8-6-9(13)11(10(14)7-8)16-5-3-1-2-4-15/h6-7,15H,1-5H2 |
| InChIKey | HGIHNXLDWKOEMJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|