C11H13Cl3O3S — CID 71968632
1,3,5-trichloro-2-(4-methylsulfonylbutoxy)benzene (PubChem CID 71968632) has the molecular formula C11H13Cl3O3S and a molecular weight of 331.65 g/mol. Its IUPAC name is 1,3,5-trichloro-2-(4-methylsulfonylbutoxy)benzene.
| Compound Name | 1,3,5-trichloro-2-(4-methylsulfonylbutoxy)benzene |
|---|---|
| PubChem CID | 71968632 |
| Molecular Formula | C11H13Cl3O3S |
| Molecular Weight | 331.65 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1,3,5-trichloro-2-(4-methylsulfonylbutoxy)benzene |
| SMILES | CS(=O)(=O)CCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl3O3S/c1-18(15,16)5-3-2-4-17-11-9(13)6-8(12)7-10(11)14/h6-7H,2-5H2,1H3 |
| InChIKey | RNNUZZBJIPWBGF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|