C15H11Cl5O3 — CID 54396483
3,5-dichloro-4-[3-(2,4,6-trichlorophenoxy)propoxy]phenol (PubChem CID 54396483) has the molecular formula C15H11Cl5O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3,5-dichloro-4-[3-(2,4,6-trichlorophenoxy)propoxy]phenol.
| Compound Name | 3,5-dichloro-4-[3-(2,4,6-trichlorophenoxy)propoxy]phenol |
|---|---|
| PubChem CID | 54396483 |
| Molecular Formula | C15H11Cl5O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 3,5-dichloro-4-[3-(2,4,6-trichlorophenoxy)propoxy]phenol |
| SMILES | Oc1cc(Cl)c(OCCCOc2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl5O3/c16-8-4-10(17)14(11(18)5-8)22-2-1-3-23-15-12(19)6-9(21)7-13(15)20/h4-7,21H,1-3H2 |
| InChIKey | VKIBUHGLBHJEDC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|