C12H11Cl3O3 — CID 68794724
3-(2,4,6-trichlorophenoxy)propyl prop-2-enoate (PubChem CID 68794724) has the molecular formula C12H11Cl3O3 and a molecular weight of 309.58 g/mol. Its IUPAC name is 3-(2,4,6-trichlorophenoxy)propyl prop-2-enoate.
| Compound Name | 3-(2,4,6-trichlorophenoxy)propyl prop-2-enoate |
|---|---|
| PubChem CID | 68794724 |
| Molecular Formula | C12H11Cl3O3 |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 3-(2,4,6-trichlorophenoxy)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3O3/c1-2-11(16)17-4-3-5-18-12-9(14)6-8(13)7-10(12)15/h2,6-7H,1,3-5H2 |
| InChIKey | ZCDZLKWWQCCTCN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|