C16H18Cl2O5 — CID 58887314
6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate (PubChem CID 58887314) has the molecular formula C16H18Cl2O5 and a molecular weight of 361.22 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate.
| Compound Name | 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 58887314 |
| Molecular Formula | C16H18Cl2O5 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2O5/c1-2-14(19)22-7-5-3-4-6-8-23-16(21)11-9-12(17)15(20)13(18)10-11/h2,9-10,20H,1,3-8H2 |
| InChIKey | KSWBHNXZPZTANU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|