6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate

C16H18Cl2O5 — CID 58887314

IUPAC6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate
SMILESC=CC(=O)OCCCCCCOC(=O)c1cc(Cl)c(O)c(Cl)c1
InChIInChI=1S/C16H18Cl2O5/c1-2-14(19)22-7-5-3-4-6-8-23-16(21)11-9-12(17)15(20)13(18)10-11/h2,9-10,20H,1,3-8H2
InChIKeyKSWBHNXZPZTANU-UHFFFAOYSA-N
MW361.22 g/mol
LogP4.15
Rot. Bonds9

About 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate

6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate (PubChem CID 58887314) has the molecular formula C16H18Cl2O5 and a molecular weight of 361.22 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate.

Molecular Properties

Compound Name6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate
PubChem CID58887314
Molecular FormulaC16H18Cl2O5
Molecular Weight361.22 g/mol
Exact Mass360.05
IUPAC Name6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate
SMILESC=CC(=O)OCCCCCCOC(=O)c1cc(Cl)c(O)c(Cl)c1
InChIInChI=1S/C16H18Cl2O5/c1-2-14(19)22-7-5-3-4-6-8-23-16(21)11-9-12(17)15(20)13(18)10-11/h2,9-10,20H,1,3-8H2
InChIKeyKSWBHNXZPZTANU-UHFFFAOYSA-N
XLogP4.15
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500361.22
LogP ≤ 54.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate?
The IUPAC name of 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate (CID 58887314) is 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate.
What is the SMILES notation for 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate?
The canonical SMILES for 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate is C=CC(=O)OCCCCCCOC(=O)c1cc(Cl)c(O)c(Cl)c1.
What is the InChIKey of 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate?
The InChIKey is KSWBHNXZPZTANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2O5/c1-2-14(19)22-7-5-3-4-6-8-23-16(21)11-9-12(17)15(20)13(18)10-11/h2,9-10,20H,1,3-8H2.
What are the key properties of 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate?
6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate has a molecular weight of 361.22 g/mol, XLogP of 4.15, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enoyloxyhexyl 3,5-dichloro-4-hydroxybenzoate is sourced from PubChem (CID 58887314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).