C14H18N2O4 — CID 141212702
4-prop-2-enoyloxybutyl 3,4-diaminobenzoate (PubChem CID 141212702) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl 3,4-diaminobenzoate.
| Compound Name | 4-prop-2-enoyloxybutyl 3,4-diaminobenzoate |
|---|---|
| PubChem CID | 141212702 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-prop-2-enoyloxybutyl 3,4-diaminobenzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-2-13(17)19-7-3-4-8-20-14(18)10-5-6-11(15)12(16)9-10/h2,5-6,9H,1,3-4,7-8,15-16H2 |
| InChIKey | TYMYWUQQEZZEEN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|