About 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate
2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate (PubChem CID 58004892) has the molecular formula C13H13ClO4
and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate |
| PubChem CID | 58004892 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate |
| SMILES | C=CC(=O)OCCOC(=O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClO4/c1-3-12(15)17-6-7-18-13(16)10-5-4-9(2)11(14)8-10/h3-5,8H,1,6-7H2,2H3 |
| InChIKey | XAIZHKIETXBCDZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate (CID 58004892) is 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate is C=CC(=O)OCCOC(=O)c1ccc(C)c(Cl)c1.
What is the InChIKey of 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate?
The InChIKey is XAIZHKIETXBCDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO4/c1-3-12(15)17-6-7-18-13(16)10-5-4-9(2)11(14)8-10/h3-5,8H,1,6-7H2,2H3.
What are the key properties of 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate?
2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate has a molecular weight of 268.70 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 3-chloro-4-methylbenzoate is sourced from PubChem (CID 58004892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).