C30H36O12 — CID 23018371
tris(4-prop-2-enoyloxybutyl) benzene-1,2,4-tricarboxylate (PubChem CID 23018371) has the molecular formula C30H36O12 and a molecular weight of 588.61 g/mol. Its IUPAC name is tris(4-prop-2-enoyloxybutyl) benzene-1,2,4-tricarboxylate.
| Compound Name | tris(4-prop-2-enoyloxybutyl) benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 23018371 |
| Molecular Formula | C30H36O12 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | tris(4-prop-2-enoyloxybutyl) benzene-1,2,4-tricarboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(C(=O)OCCCCOC(=O)C=C)c(C(=O)OCCCCOC(=O)C=C)c1 |
| InChI | InChI=1S/C30H36O12/c1-4-25(31)37-15-7-10-18-40-28(34)22-13-14-23(29(35)41-19-11-8-16-38-26(32)5-2)24(21-22)30(36)42-20-12-9-17-39-27(33)6-3/h4-6,13-14,21H,1-3,7-12,15-20H2 |
| InChIKey | IRHSHWMVQCAVMI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|