C47H58O12 — CID 142663092
2-O-hexyl 1-O,4-O-bis[4-(7-prop-2-enoyloxyheptoxy)phenyl] benzene-1,2,4-tricarboxylate (PubChem CID 142663092) has the molecular formula C47H58O12 and a molecular weight of 814.97 g/mol. Its IUPAC name is 2-O-hexyl 1-O,4-O-bis[4-(7-prop-2-enoyloxyheptoxy)phenyl] benzene-1,2,4-tricarboxylate.
| Compound Name | 2-O-hexyl 1-O,4-O-bis[4-(7-prop-2-enoyloxyheptoxy)phenyl] benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 142663092 |
| Molecular Formula | C47H58O12 |
| Molecular Weight | 814.97 g/mol |
| Exact Mass | 814.39 |
| IUPAC Name | 2-O-hexyl 1-O,4-O-bis[4-(7-prop-2-enoyloxyheptoxy)phenyl] benzene-1,2,4-tricarboxylate |
| SMILES | C=CC(=O)OCCCCCCCOc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(OCCCCCCCOC(=O)C=C)cc3)c(C(=O)OCCCCCC)c2)cc1 |
| InChI | InChI=1S/C47H58O12/c1-4-7-8-15-34-57-46(51)42-35-36(45(50)58-39-25-21-37(22-26-39)53-30-16-11-9-13-18-32-55-43(48)5-2)20-29-41(42)47(52)59-40-27-23-38(24-28-40)54-31-17-12-10-14-19-33-56-44(49)6-3/h5-6,20-29,35H,2-4,7-19,30-34H2,1H3 |
| InChIKey | SXQHPXIISQGEHY-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.97 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|